About benzene;ethyl acetate;3-phenylpropan-1-ol
benzene;ethyl acetate;3-phenylpropan-1-ol (PubChem CID 158644115) has the molecular formula C19H26O3
and a molecular weight of 302.41 g/mol. Its IUPAC name is benzene;ethyl acetate;3-phenylpropan-1-ol.
Molecular Properties
| Compound Name | benzene;ethyl acetate;3-phenylpropan-1-ol |
| PubChem CID | 158644115 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | benzene;ethyl acetate;3-phenylpropan-1-ol |
| SMILES | CCOC(C)=O.OCCCc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H12O.C6H6.C4H8O2/c10-8-4-7-9-5-2-1-3-6-9;1-2-4-6-5-3-1;1-3-6-4(2)5/h1-3,5-6,10H,4,7-8H2;1-6H;3H2,1-2H3 |
| InChIKey | IATDSBOUCRKBHZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;ethyl acetate;3-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethyl acetate;3-phenylpropan-1-ol?
The IUPAC name of benzene;ethyl acetate;3-phenylpropan-1-ol (CID 158644115) is benzene;ethyl acetate;3-phenylpropan-1-ol.
What is the SMILES notation for benzene;ethyl acetate;3-phenylpropan-1-ol?
The canonical SMILES for benzene;ethyl acetate;3-phenylpropan-1-ol is CCOC(C)=O.OCCCc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;ethyl acetate;3-phenylpropan-1-ol?
The InChIKey is IATDSBOUCRKBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C6H6.C4H8O2/c10-8-4-7-9-5-2-1-3-6-9;1-2-4-6-5-3-1;1-3-6-4(2)5/h1-3,5-6,10H,4,7-8H2;1-6H;3H2,1-2H3.
What are the key properties of benzene;ethyl acetate;3-phenylpropan-1-ol?
benzene;ethyl acetate;3-phenylpropan-1-ol has a molecular weight of 302.41 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethyl acetate;3-phenylpropan-1-ol is sourced from PubChem (CID 158644115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).