C12H29N3O3 — CID 174939925
4-hydroxy-2-(propylamino)butanoic acid;pentane-1,1-diamine (PubChem CID 174939925) has the molecular formula C12H29N3O3 and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-hydroxy-2-(propylamino)butanoic acid;pentane-1,1-diamine.
| Compound Name | 4-hydroxy-2-(propylamino)butanoic acid;pentane-1,1-diamine |
|---|---|
| PubChem CID | 174939925 |
| Molecular Formula | C12H29N3O3 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-hydroxy-2-(propylamino)butanoic acid;pentane-1,1-diamine |
| SMILES | CCCCC(N)N.CCCNC(CCO)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C5H14N2/c1-2-4-8-6(3-5-9)7(10)11;1-2-3-4-5(6)7/h6,8-9H,2-5H2,1H3,(H,10,11);5H,2-4,6-7H2,1H3 |
| InChIKey | HIUFUNZQDNSSIJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|