About disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate
disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate (PubChem CID 161259430) has the molecular formula C8H15NNa2O6
and a molecular weight of 267.19 g/mol. Its IUPAC name is disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate.
Molecular Properties
| Compound Name | disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate |
| PubChem CID | 161259430 |
| Molecular Formula | C8H15NNa2O6 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate |
| SMILES | CCCN[C@@H](CCO)C(=O)O.O=C([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H15NO3.CH2O3.2Na/c1-2-4-8-6(3-5-9)7(10)11;2-1(3)4;;/h6,8-9H,2-5H2,1H3,(H,10,11);(H2,2,3,4);;/q;;2*+1/p-2/t6-;;;/m0.../s1 |
| InChIKey | VHLQBBMEEZENMN-GSUNZCPGSA-L |
| XLogP | -8.62 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | -8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate?
The IUPAC name of disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate (CID 161259430) is disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate.
What is the SMILES notation for disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate?
The canonical SMILES for disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate is CCCN[C@@H](CCO)C(=O)O.O=C([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate?
The InChIKey is VHLQBBMEEZENMN-GSUNZCPGSA-L. The full InChI is InChI=1S/C7H15NO3.CH2O3.2Na/c1-2-4-8-6(3-5-9)7(10)11;2-1(3)4;;/h6,8-9H,2-5H2,1H3,(H,10,11);(H2,2,3,4);;/q;;2*+1/p-2/t6-;;;/m0.../s1.
What are the key properties of disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate?
disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate has a molecular weight of 267.19 g/mol, XLogP of -8.62, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-4-hydroxy-2-(propylamino)butanoic acid;carbonate is sourced from PubChem (CID 161259430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).