C7H17NO7S — CID 172821173
(2S)-4-hydroxy-2-(propylamino)butanoic acid;sulfuric acid (PubChem CID 172821173) has the molecular formula C7H17NO7S and a molecular weight of 259.28 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(propylamino)butanoic acid;sulfuric acid.
| Compound Name | (2S)-4-hydroxy-2-(propylamino)butanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 172821173 |
| Molecular Formula | C7H17NO7S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (2S)-4-hydroxy-2-(propylamino)butanoic acid;sulfuric acid |
| SMILES | CCCN[C@@H](CCO)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C7H15NO3.H2O4S/c1-2-4-8-6(3-5-9)7(10)11;1-5(2,3)4/h6,8-9H,2-5H2,1H3,(H,10,11);(H2,1,2,3,4)/t6-;/m0./s1 |
| InChIKey | UGAMLVNMNCTMHO-RGMNGODLSA-N |
| XLogP | -0.83 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|