C11H24N2O6Zn2 — CID 174949324
2-amino-3-hydroxybutanoic acid;4-hydroxy-2-(propylamino)butanoic acid;zinc (PubChem CID 174949324) has the molecular formula C11H24N2O6Zn2 and a molecular weight of 411.10 g/mol. Its IUPAC name is 2-amino-3-hydroxybutanoic acid;4-hydroxy-2-(propylamino)butanoic acid;zinc.
| Compound Name | 2-amino-3-hydroxybutanoic acid;4-hydroxy-2-(propylamino)butanoic acid;zinc |
|---|---|
| PubChem CID | 174949324 |
| Molecular Formula | C11H24N2O6Zn2 |
| Molecular Weight | 411.10 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-amino-3-hydroxybutanoic acid;4-hydroxy-2-(propylamino)butanoic acid;zinc |
| SMILES | CC(O)C(N)C(=O)O.CCCNC(CCO)C(=O)O.[Zn].[Zn] |
| InChI | InChI=1S/C7H15NO3.C4H9NO3.2Zn/c1-2-4-8-6(3-5-9)7(10)11;1-2(6)3(5)4(7)8;;/h6,8-9H,2-5H2,1H3,(H,10,11);2-3,6H,5H2,1H3,(H,7,8);; |
| InChIKey | DDBSEOBUMWCEPB-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.10 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|