C13H30N4O4 — CID 174410111
5-amino-2-(4-hydroxybutylamino)-5-oxopentanoic acid;butane-1,1-diamine (PubChem CID 174410111) has the molecular formula C13H30N4O4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-amino-2-(4-hydroxybutylamino)-5-oxopentanoic acid;butane-1,1-diamine.
| Compound Name | 5-amino-2-(4-hydroxybutylamino)-5-oxopentanoic acid;butane-1,1-diamine |
|---|---|
| PubChem CID | 174410111 |
| Molecular Formula | C13H30N4O4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 5-amino-2-(4-hydroxybutylamino)-5-oxopentanoic acid;butane-1,1-diamine |
| SMILES | CCCC(N)N.NC(=O)CCC(NCCCCO)C(=O)O |
| InChI | InChI=1S/C9H18N2O4.C4H12N2/c10-8(13)4-3-7(9(14)15)11-5-1-2-6-12;1-2-3-4(5)6/h7,11-12H,1-6H2,(H2,10,13)(H,14,15);4H,2-3,5-6H2,1H3 |
| InChIKey | PEMJWRKAQPXXHY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|