C15H31N3O5S — CID 174835481
2,5-diamino-5-oxopentanoic acid;4-methylsulfanyl-2-(pentylamino)butanoic acid (PubChem CID 174835481) has the molecular formula C15H31N3O5S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2,5-diamino-5-oxopentanoic acid;4-methylsulfanyl-2-(pentylamino)butanoic acid.
| Compound Name | 2,5-diamino-5-oxopentanoic acid;4-methylsulfanyl-2-(pentylamino)butanoic acid |
|---|---|
| PubChem CID | 174835481 |
| Molecular Formula | C15H31N3O5S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2,5-diamino-5-oxopentanoic acid;4-methylsulfanyl-2-(pentylamino)butanoic acid |
| SMILES | CCCCCNC(CCSC)C(=O)O.NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C10H21NO2S.C5H10N2O3/c1-3-4-5-7-11-9(10(12)13)6-8-14-2;6-3(5(9)10)1-2-4(7)8/h9,11H,3-8H2,1-2H3,(H,12,13);3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | NLOSLQLJNNOCTK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|