C14H22ClNO3 — CID 172732914
benzyl (2S)-4-hydroxy-2-(propylamino)butanoate;hydrochloride (PubChem CID 172732914) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is benzyl (2S)-4-hydroxy-2-(propylamino)butanoate;hydrochloride.
| Compound Name | benzyl (2S)-4-hydroxy-2-(propylamino)butanoate;hydrochloride |
|---|---|
| PubChem CID | 172732914 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | benzyl (2S)-4-hydroxy-2-(propylamino)butanoate;hydrochloride |
| SMILES | CCCN[C@@H](CCO)C(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-2-9-15-13(8-10-16)14(17)18-11-12-6-4-3-5-7-12;/h3-7,13,15-16H,2,8-11H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | IAQAQTSXFKKFNZ-ZOWNYOTGSA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |