C13H14F3NO4 — CID 18639965
benzyl (2S)-4-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 18639965) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is benzyl (2S)-4-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | benzyl (2S)-4-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 18639965 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | benzyl (2S)-4-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](CCO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO4/c14-13(15,16)12(20)17-10(6-7-18)11(19)21-8-9-4-2-1-3-5-9/h1-5,10,18H,6-8H2,(H,17,20)/t10-/m0/s1 |
| InChIKey | GROWNGOJUOIBLP-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |