(2R)-2-(ethylamino)-5-phenylpentanoic acid

C13H19NO2 — CID 151918023

IUPAC(2R)-2-(ethylamino)-5-phenylpentanoic acid
SMILESCCN[C@H](CCCc1ccccc1)C(=O)O
InChIInChI=1S/C13H19NO2/c1-2-14-12(13(15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,12,14H,2,6,9-10H2,1H3,(H,15,16)/t12-/m1/s1
InChIKeySWEFFVQJTNRZSU-GFCCVEGCSA-N
MW221.30 g/mol
LogP2.07
Rot. Bonds7

About (2R)-2-(ethylamino)-5-phenylpentanoic acid

(2R)-2-(ethylamino)-5-phenylpentanoic acid (PubChem CID 151918023) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R)-2-(ethylamino)-5-phenylpentanoic acid.

Molecular Properties

Compound Name(2R)-2-(ethylamino)-5-phenylpentanoic acid
PubChem CID151918023
Molecular FormulaC13H19NO2
Molecular Weight221.30 g/mol
Exact Mass221.14
IUPAC Name(2R)-2-(ethylamino)-5-phenylpentanoic acid
SMILESCCN[C@H](CCCc1ccccc1)C(=O)O
InChIInChI=1S/C13H19NO2/c1-2-14-12(13(15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,12,14H,2,6,9-10H2,1H3,(H,15,16)/t12-/m1/s1
InChIKeySWEFFVQJTNRZSU-GFCCVEGCSA-N
XLogP2.07
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.30
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(ethylamino)-5-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(benzylamino)hexanoic acid
CID 129366307
fermium;2-(oxomethylamino)-5-phenylpentanoic acid
CID 166481787
3-methyl-6-phenylhexan-2-one
CID 59396975
2-(ethylamino)-3-[methyl(2-phenylethyl)amino]propanoic acid
CID 65485946
2-[[2-oxo-2-(3-phenylpropylamino)ethyl]amino]pentanoic acid
CID 43631427
2-(benzylamino)nonanoic acid
CID 54889620
(2S)-2-acetamido-7-phenylheptanoic acid
CID 129362724
2-[[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]-5-phenylpentanoic acid
CID 174469456
methyl 2-(ethylamino)-4-(3-phenylpropoxy)butanoate
CID 63034614
(2S)-4-phenyl-2-(2-phenylethylamino)butanoic acid
CID 141046981
(2S)-5-phenyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid
CID 14390812
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid
CID 2761801

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(ethylamino)-5-phenylpentanoic acid?
The IUPAC name of (2R)-2-(ethylamino)-5-phenylpentanoic acid (CID 151918023) is (2R)-2-(ethylamino)-5-phenylpentanoic acid.
What is the SMILES notation for (2R)-2-(ethylamino)-5-phenylpentanoic acid?
The canonical SMILES for (2R)-2-(ethylamino)-5-phenylpentanoic acid is CCN[C@H](CCCc1ccccc1)C(=O)O.
What is the InChIKey of (2R)-2-(ethylamino)-5-phenylpentanoic acid?
The InChIKey is SWEFFVQJTNRZSU-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-14-12(13(15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,12,14H,2,6,9-10H2,1H3,(H,15,16)/t12-/m1/s1.
What are the key properties of (2R)-2-(ethylamino)-5-phenylpentanoic acid?
(2R)-2-(ethylamino)-5-phenylpentanoic acid has a molecular weight of 221.30 g/mol, XLogP of 2.07, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(ethylamino)-5-phenylpentanoic acid is sourced from PubChem (CID 151918023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).