fermium;2-(oxomethylamino)-5-phenylpentanoic acid

C12H14FmNO3- — CID 166481787

IUPACfermium;2-(oxomethylamino)-5-phenylpentanoic acid
SMILESO=[C-]NC(CCCc1ccccc1)C(=O)O.[Fm]
InChIInChI=1S/C12H14NO3.Fm/c14-9-13-11(12(15)16)8-4-7-10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-8H2,(H,13,14)(H,15,16);/q-1;
InChIKeyVHQFQHUJVUPVSP-UHFFFAOYSA-N
MW477.25 g/mol
LogP1.12
Rot. Bonds7

About fermium;2-(oxomethylamino)-5-phenylpentanoic acid

fermium;2-(oxomethylamino)-5-phenylpentanoic acid (PubChem CID 166481787) has the molecular formula C12H14FmNO3- and a molecular weight of 477.25 g/mol. Its IUPAC name is fermium;2-(oxomethylamino)-5-phenylpentanoic acid.

Molecular Properties

Compound Namefermium;2-(oxomethylamino)-5-phenylpentanoic acid
PubChem CID166481787
Molecular FormulaC12H14FmNO3-
Molecular Weight477.25 g/mol
Exact Mass477.19
IUPAC Namefermium;2-(oxomethylamino)-5-phenylpentanoic acid
SMILESO=[C-]NC(CCCc1ccccc1)C(=O)O.[Fm]
InChIInChI=1S/C12H14NO3.Fm/c14-9-13-11(12(15)16)8-4-7-10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-8H2,(H,13,14)(H,15,16);/q-1;
InChIKeyVHQFQHUJVUPVSP-UHFFFAOYSA-N
XLogP1.12
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500477.25
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}

Analyze fermium;2-(oxomethylamino)-5-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fermium;2-(oxomethylamino)-5-phenylpentanoic acid?
The IUPAC name of fermium;2-(oxomethylamino)-5-phenylpentanoic acid (CID 166481787) is fermium;2-(oxomethylamino)-5-phenylpentanoic acid.
What is the SMILES notation for fermium;2-(oxomethylamino)-5-phenylpentanoic acid?
The canonical SMILES for fermium;2-(oxomethylamino)-5-phenylpentanoic acid is O=[C-]NC(CCCc1ccccc1)C(=O)O.[Fm].
What is the InChIKey of fermium;2-(oxomethylamino)-5-phenylpentanoic acid?
The InChIKey is VHQFQHUJVUPVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14NO3.Fm/c14-9-13-11(12(15)16)8-4-7-10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-8H2,(H,13,14)(H,15,16);/q-1;.
What are the key properties of fermium;2-(oxomethylamino)-5-phenylpentanoic acid?
fermium;2-(oxomethylamino)-5-phenylpentanoic acid has a molecular weight of 477.25 g/mol, XLogP of 1.12, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fermium;2-(oxomethylamino)-5-phenylpentanoic acid is sourced from PubChem (CID 166481787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).