C12H14FmNO3- — CID 166481787
fermium;2-(oxomethylamino)-5-phenylpentanoic acid (PubChem CID 166481787) has the molecular formula C12H14FmNO3- and a molecular weight of 477.25 g/mol. Its IUPAC name is fermium;2-(oxomethylamino)-5-phenylpentanoic acid.
| Compound Name | fermium;2-(oxomethylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 166481787 |
| Molecular Formula | C12H14FmNO3- |
| Molecular Weight | 477.25 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | fermium;2-(oxomethylamino)-5-phenylpentanoic acid |
| SMILES | O=[C-]NC(CCCc1ccccc1)C(=O)O.[Fm] |
| InChI | InChI=1S/C12H14NO3.Fm/c14-9-13-11(12(15)16)8-4-7-10-5-2-1-3-6-10;/h1-3,5-6,11H,4,7-8H2,(H,13,14)(H,15,16);/q-1; |
| InChIKey | VHQFQHUJVUPVSP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|