C11H12FmNO3- — CID 166481750
fermium;3-(3-methylphenyl)-2-(oxomethylamino)propanoic acid (PubChem CID 166481750) has the molecular formula C11H12FmNO3- and a molecular weight of 463.22 g/mol. Its IUPAC name is fermium;3-(3-methylphenyl)-2-(oxomethylamino)propanoic acid.
| Compound Name | fermium;3-(3-methylphenyl)-2-(oxomethylamino)propanoic acid |
|---|---|
| PubChem CID | 166481750 |
| Molecular Formula | C11H12FmNO3- |
| Molecular Weight | 463.22 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | fermium;3-(3-methylphenyl)-2-(oxomethylamino)propanoic acid |
| SMILES | Cc1cccc(CC(N[C-]=O)C(=O)O)c1.[Fm] |
| InChI | InChI=1S/C11H12NO3.Fm/c1-8-3-2-4-9(5-8)6-10(11(14)15)12-7-13;/h2-5,10H,6H2,1H3,(H,12,13)(H,14,15);/q-1; |
| InChIKey | TYHBOEOQGIVKIL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|