C10H11BFmNO5- — CID 166490326
(2S)-3-(4-boronophenyl)-2-(oxomethylamino)propanoic acid;fermium (PubChem CID 166490326) has the molecular formula C10H11BFmNO5- and a molecular weight of 493.01 g/mol. Its IUPAC name is (2S)-3-(4-boronophenyl)-2-(oxomethylamino)propanoic acid;fermium.
| Compound Name | (2S)-3-(4-boronophenyl)-2-(oxomethylamino)propanoic acid;fermium |
|---|---|
| PubChem CID | 166490326 |
| Molecular Formula | C10H11BFmNO5- |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (2S)-3-(4-boronophenyl)-2-(oxomethylamino)propanoic acid;fermium |
| SMILES | O=[C-]N[C@@H](Cc1ccc(B(O)O)cc1)C(=O)O.[Fm] |
| InChI | InChI=1S/C10H11BNO5.Fm/c13-6-12-9(10(14)15)5-7-1-3-8(4-2-7)11(16)17;/h1-4,9,16-17H,5H2,(H,12,13)(H,14,15);/q-1;/t9-;/m0./s1 |
| InChIKey | AIWKKYJTRPZYMS-FVGYRXGTSA-N |
| XLogP | -1.98 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|