C8H7BrFmNO3S- — CID 166481901
(2S)-3-(5-bromothiophen-2-yl)-2-(oxomethylamino)propanoic acid;fermium (PubChem CID 166481901) has the molecular formula C8H7BrFmNO3S- and a molecular weight of 534.12 g/mol. Its IUPAC name is (2S)-3-(5-bromothiophen-2-yl)-2-(oxomethylamino)propanoic acid;fermium.
| Compound Name | (2S)-3-(5-bromothiophen-2-yl)-2-(oxomethylamino)propanoic acid;fermium |
|---|---|
| PubChem CID | 166481901 |
| Molecular Formula | C8H7BrFmNO3S- |
| Molecular Weight | 534.12 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | (2S)-3-(5-bromothiophen-2-yl)-2-(oxomethylamino)propanoic acid;fermium |
| SMILES | O=[C-]N[C@@H](Cc1ccc(Br)s1)C(=O)O.[Fm] |
| InChI | InChI=1S/C8H7BrNO3S.Fm/c9-7-2-1-5(14-7)3-6(8(12)13)10-4-11;/h1-2,6H,3H2,(H,10,11)(H,12,13);/q-1;/t6-;/m0./s1 |
| InChIKey | BSYMTURGPLXQCH-RGMNGODLSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|