C10H15BrN2O2S — CID 115256232
3-[2-(5-bromothiophen-2-yl)ethylamino]-2-(methylamino)propanoic acid (PubChem CID 115256232) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 3-[2-(5-bromothiophen-2-yl)ethylamino]-2-(methylamino)propanoic acid.
| Compound Name | 3-[2-(5-bromothiophen-2-yl)ethylamino]-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 115256232 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-[2-(5-bromothiophen-2-yl)ethylamino]-2-(methylamino)propanoic acid |
| SMILES | CNC(CNCCc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H15BrN2O2S/c1-12-8(10(14)15)6-13-5-4-7-2-3-9(11)16-7/h2-3,8,12-13H,4-6H2,1H3,(H,14,15) |
| InChIKey | SKOIEXLIWDOJMC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|