C12H17BrN2O4S — CID 106040463
2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-4-methoxybutanoic acid (PubChem CID 106040463) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 106040463 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)NCCc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C12H17BrN2O4S/c1-19-7-5-9(11(16)17)15-12(18)14-6-4-8-2-3-10(13)20-8/h2-3,9H,4-7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | UJXJLXLCLJGSQC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |