C14H22BrN3O2S — CID 95764593
(2R)-2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-N-[(2R)-butan-2-yl]propanamide (PubChem CID 95764593) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is (2R)-2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-N-[(2R)-butan-2-yl]propanamide.
| Compound Name | (2R)-2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-N-[(2R)-butan-2-yl]propanamide |
|---|---|
| PubChem CID | 95764593 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2R)-2-[2-(5-bromothiophen-2-yl)ethylcarbamoylamino]-N-[(2R)-butan-2-yl]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)NC(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-4-9(2)17-13(19)10(3)18-14(20)16-8-7-11-5-6-12(15)21-11/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,19)(H2,16,18,20)/t9-,10-/m1/s1 |
| InChIKey | UVLUXSYAYOYARO-NXEZZACHSA-N |
| XLogP | 2.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |