C11H15BrN2O3S — CID 106047987
ethyl 2-amino-3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropanoate (PubChem CID 106047987) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is ethyl 2-amino-3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 106047987 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | ethyl 2-amino-3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H15BrN2O3S/c1-2-17-11(16)9(13)10(15)14-6-5-7-3-4-8(12)18-7/h3-4,9H,2,5-6,13H2,1H3,(H,14,15) |
| InChIKey | CCCYHFJMRTUWOP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|