C10H15BrN2OS — CID 103808340
3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]butanamide (PubChem CID 103808340) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]butanamide.
| Compound Name | 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 103808340 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]butanamide |
| SMILES | CC(N)CC(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2OS/c1-7(12)6-10(14)13-5-4-8-2-3-9(11)15-8/h2-3,7H,4-6,12H2,1H3,(H,13,14) |
| InChIKey | FXNQJQXIHDGKFR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |