C9H9BrN2OS — CID 104696927
N-[2-(5-bromothiophen-2-yl)ethyl]-2-cyanoacetamide (PubChem CID 104696927) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2-cyanoacetamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 104696927 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C9H9BrN2OS/c10-8-2-1-7(14-8)4-6-12-9(13)3-5-11/h1-2H,3-4,6H2,(H,12,13) |
| InChIKey | YUZJWQXKFJRSSD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |