C14H23BrN2OS — CID 106048077
3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5,5-dimethylhexanamide (PubChem CID 106048077) has the molecular formula C14H23BrN2OS and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5,5-dimethylhexanamide.
| Compound Name | 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 106048077 |
| Molecular Formula | C14H23BrN2OS |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H23BrN2OS/c1-14(2,3)9-10(16)8-13(18)17-7-6-11-4-5-12(15)19-11/h4-5,10H,6-9,16H2,1-3H3,(H,17,18) |
| InChIKey | QDGAQHPCDLETIR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |