C16H19BrN2OS — CID 106048013
2-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-4-phenylbutanamide (PubChem CID 106048013) has the molecular formula C16H19BrN2OS and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-4-phenylbutanamide.
| Compound Name | 2-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 106048013 |
| Molecular Formula | C16H19BrN2OS |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-amino-N-[2-(5-bromothiophen-2-yl)ethyl]-4-phenylbutanamide |
| SMILES | NC(CCc1ccccc1)C(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C16H19BrN2OS/c17-15-9-7-13(21-15)10-11-19-16(20)14(18)8-6-12-4-2-1-3-5-12/h1-5,7,9,14H,6,8,10-11,18H2,(H,19,20) |
| InChIKey | YILLLKLYMQSPCT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |