C20H18BrNOS — CID 17415290
N-[2-(5-bromothiophen-2-yl)ethyl]-2,2-diphenylacetamide (PubChem CID 17415290) has the molecular formula C20H18BrNOS and a molecular weight of 400.34 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17415290 |
| Molecular Formula | C20H18BrNOS |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCc1ccc(Br)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18BrNOS/c21-18-12-11-17(24-18)13-14-22-20(23)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,19H,13-14H2,(H,22,23) |
| InChIKey | PMDYHMUTDMFSHL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |