C16H16BrNO3S — CID 119182566
4-[3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropyl]benzoic acid (PubChem CID 119182566) has the molecular formula C16H16BrNO3S and a molecular weight of 382.28 g/mol. Its IUPAC name is 4-[3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119182566 |
| Molecular Formula | C16H16BrNO3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 4-[3-[2-(5-bromothiophen-2-yl)ethylamino]-3-oxopropyl]benzoic acid |
| SMILES | O=C(CCc1ccc(C(=O)O)cc1)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C16H16BrNO3S/c17-14-7-6-13(22-14)9-10-18-15(19)8-3-11-1-4-12(5-2-11)16(20)21/h1-2,4-7H,3,8-10H2,(H,18,19)(H,20,21) |
| InChIKey | FBCPVGLAKVTGKG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |