C14H19NO5S — CID 119184166
4-[3-(2-ethylsulfonylethylamino)-3-oxopropyl]benzoic acid (PubChem CID 119184166) has the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. Its IUPAC name is 4-[3-(2-ethylsulfonylethylamino)-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-(2-ethylsulfonylethylamino)-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119184166 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-[3-(2-ethylsulfonylethylamino)-3-oxopropyl]benzoic acid |
| SMILES | CCS(=O)(=O)CCNC(=O)CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-2-21(19,20)10-9-15-13(16)8-5-11-3-6-12(7-4-11)14(17)18/h3-4,6-7H,2,5,8-10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | JSVRITQAOSVFOL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |