C17H24N2O4 — CID 75415241
4-[2-[3-(2,2-dimethylpropanoylamino)propanoylamino]ethyl]benzoic acid (PubChem CID 75415241) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[2-[3-(2,2-dimethylpropanoylamino)propanoylamino]ethyl]benzoic acid.
| Compound Name | 4-[2-[3-(2,2-dimethylpropanoylamino)propanoylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 75415241 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-[2-[3-(2,2-dimethylpropanoylamino)propanoylamino]ethyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)NCCC(=O)NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(2,3)16(23)19-11-9-14(20)18-10-8-12-4-6-13(7-5-12)15(21)22/h4-7H,8-11H2,1-3H3,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | LEIXLMSZAKFQSO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |