C16H21NO3 — CID 120512953
4-[2-(3-cyclobutylpropanoylamino)ethyl]benzoic acid (PubChem CID 120512953) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[2-(3-cyclobutylpropanoylamino)ethyl]benzoic acid.
| Compound Name | 4-[2-(3-cyclobutylpropanoylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 120512953 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[2-(3-cyclobutylpropanoylamino)ethyl]benzoic acid |
| SMILES | O=C(CCC1CCC1)NCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H21NO3/c18-15(9-6-12-2-1-3-12)17-11-10-13-4-7-14(8-5-13)16(19)20/h4-5,7-8,12H,1-3,6,9-11H2,(H,17,18)(H,19,20) |
| InChIKey | IOKWHIYUWHFUBI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |