C17H23NO3 — CID 63793330
3-[2-(3-cyclopentylpropanoylamino)ethyl]benzoic acid (PubChem CID 63793330) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 3-[2-(3-cyclopentylpropanoylamino)ethyl]benzoic acid.
| Compound Name | 3-[2-(3-cyclopentylpropanoylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 63793330 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[2-(3-cyclopentylpropanoylamino)ethyl]benzoic acid |
| SMILES | O=C(CCC1CCCC1)NCCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO3/c19-16(9-8-13-4-1-2-5-13)18-11-10-14-6-3-7-15(12-14)17(20)21/h3,6-7,12-13H,1-2,4-5,8-11H2,(H,18,19)(H,20,21) |
| InChIKey | GWPHWHDHWXSYRR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |