C19H29NO3 — CID 156687030
N-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-3-cyclohexylpropanamide (PubChem CID 156687030) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-3-cyclohexylpropanamide.
| Compound Name | N-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 156687030 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)NCCc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C19H29NO3/c21-13-17-8-6-16(12-18(17)14-22)10-11-20-19(23)9-7-15-4-2-1-3-5-15/h6,8,12,15,21-22H,1-5,7,9-11,13-14H2,(H,20,23) |
| InChIKey | JJNDZGXZJPOFAZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |