C16H17NO3S — CID 119180358
4-[3-[(5-methylthiophen-2-yl)methylamino]-3-oxopropyl]benzoic acid (PubChem CID 119180358) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-[3-[(5-methylthiophen-2-yl)methylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[(5-methylthiophen-2-yl)methylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119180358 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[3-[(5-methylthiophen-2-yl)methylamino]-3-oxopropyl]benzoic acid |
| SMILES | Cc1ccc(CNC(=O)CCc2ccc(C(=O)O)cc2)s1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-2-8-14(21-11)10-17-15(18)9-5-12-3-6-13(7-4-12)16(19)20/h2-4,6-8H,5,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XWLLTWZIQQJDKY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |