C11H15ClN2O4S — CID 106039755
2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]-3-methoxypropanoic acid (PubChem CID 106039755) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 106039755 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)NCCc1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O4S/c1-18-6-8(10(15)16)14-11(17)13-5-4-7-2-3-9(12)19-7/h2-3,8H,4-6H2,1H3,(H,15,16)(H2,13,14,17) |
| InChIKey | OFKPWZQJMHKDMN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |