C9H14BrN3OS — CID 116849920
2-amino-3-(5-bromothiophen-2-yl)-N',N'-dimethylpropanehydrazide (PubChem CID 116849920) has the molecular formula C9H14BrN3OS and a molecular weight of 292.20 g/mol. Its IUPAC name is 2-amino-3-(5-bromothiophen-2-yl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 2-amino-3-(5-bromothiophen-2-yl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116849920 |
| Molecular Formula | C9H14BrN3OS |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-amino-3-(5-bromothiophen-2-yl)-N',N'-dimethylpropanehydrazide |
| SMILES | CN(C)NC(=O)C(N)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C9H14BrN3OS/c1-13(2)12-9(14)7(11)5-6-3-4-8(10)15-6/h3-4,7H,5,11H2,1-2H3,(H,12,14) |
| InChIKey | KJESERDFXLIAJC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|