C10H16BrClN2OS — CID 119688978
3-amino-N-[(5-bromothiophen-2-yl)methyl]-N-methylbutanamide;hydrochloride (PubChem CID 119688978) has the molecular formula C10H16BrClN2OS and a molecular weight of 327.68 g/mol. Its IUPAC name is 3-amino-N-[(5-bromothiophen-2-yl)methyl]-N-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-[(5-bromothiophen-2-yl)methyl]-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119688978 |
| Molecular Formula | C10H16BrClN2OS |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-amino-N-[(5-bromothiophen-2-yl)methyl]-N-methylbutanamide;hydrochloride |
| SMILES | CC(N)CC(=O)N(C)Cc1ccc(Br)s1.Cl |
| InChI | InChI=1S/C10H15BrN2OS.ClH/c1-7(12)5-10(14)13(2)6-8-3-4-9(11)15-8;/h3-4,7H,5-6,12H2,1-2H3;1H |
| InChIKey | QTRNCRGFUSYBRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |