C15H18BrClN2OS — CID 120608213
3-(2-aminophenyl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide;hydrochloride (PubChem CID 120608213) has the molecular formula C15H18BrClN2OS and a molecular weight of 389.75 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120608213 |
| Molecular Formula | C15H18BrClN2OS |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 3-(2-aminophenyl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylpropanamide;hydrochloride |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C15H17BrN2OS.ClH/c1-18(10-12-7-8-14(16)20-12)15(19)9-6-11-4-2-3-5-13(11)17;/h2-5,7-8H,6,9-10,17H2,1H3;1H |
| InChIKey | BQDKOXJHXDLAPG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|