C18H21ClN2O3 — CID 120608250
3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-methylpropanamide;hydrochloride (PubChem CID 120608250) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-methylpropanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120608250 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-methylpropanamide;hydrochloride |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C18H20N2O3.ClH/c1-20(11-13-6-8-16-17(10-13)23-12-22-16)18(21)9-7-14-4-2-3-5-15(14)19;/h2-6,8,10H,7,9,11-12,19H2,1H3;1H |
| InChIKey | YKFDHXBIWMFRDP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|