C20H25ClN2O4 — CID 120610684
3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)propanamide;hydrochloride (PubChem CID 120610684) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120610684 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)propanamide;hydrochloride |
| SMILES | COCCN(Cc1ccc2c(c1)OCO2)C(=O)CCc1ccccc1N.Cl |
| InChI | InChI=1S/C20H24N2O4.ClH/c1-24-11-10-22(13-15-6-8-18-19(12-15)26-14-25-18)20(23)9-7-16-4-2-3-5-17(16)21;/h2-6,8,12H,7,9-11,13-14,21H2,1H3;1H |
| InChIKey | HJPXBHCSMFCLSZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|