C19H23ClN2O4 — CID 120632437
5-amino-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride (PubChem CID 120632437) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is 5-amino-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120632437 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 5-amino-N-(1,3-benzodioxol-5-ylmethyl)-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride |
| SMILES | COCCN(Cc1ccc2c(c1)OCO2)C(=O)c1cc(N)ccc1C.Cl |
| InChI | InChI=1S/C19H22N2O4.ClH/c1-13-3-5-15(20)10-16(13)19(22)21(7-8-23-2)11-14-4-6-17-18(9-14)25-12-24-17;/h3-6,9-10H,7-8,11-12,20H2,1-2H3;1H |
| InChIKey | OAGKHOCRGXNHNB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|