C16H22N2O6 — CID 122023297
4-[[1,3-benzodioxol-5-ylmethyl(2-methoxyethyl)carbamoyl]amino]butanoic acid (PubChem CID 122023297) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[[1,3-benzodioxol-5-ylmethyl(2-methoxyethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[1,3-benzodioxol-5-ylmethyl(2-methoxyethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122023297 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[[1,3-benzodioxol-5-ylmethyl(2-methoxyethyl)carbamoyl]amino]butanoic acid |
| SMILES | COCCN(Cc1ccc2c(c1)OCO2)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C16H22N2O6/c1-22-8-7-18(16(21)17-6-2-3-15(19)20)10-12-4-5-13-14(9-12)24-11-23-13/h4-5,9H,2-3,6-8,10-11H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | DMQHDSFVXCOCPN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|