C21H27N3O3 — CID 51290301
1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(N-methylanilino)propyl]urea (PubChem CID 51290301) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(N-methylanilino)propyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 51290301 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(N-methylanilino)propyl]urea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O3/c1-3-24(15-17-10-11-19-20(14-17)27-16-26-19)21(25)22-12-7-13-23(2)18-8-5-4-6-9-18/h4-6,8-11,14H,3,7,12-13,15-16H2,1-2H3,(H,22,25) |
| InChIKey | ZEYRKMRRGARONU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|