C18H19NO4 — CID 70700680
benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate (PubChem CID 70700680) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate.
| Compound Name | benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate |
|---|---|
| PubChem CID | 70700680 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-2-19(18(20)21-12-14-6-4-3-5-7-14)11-15-8-9-16-17(10-15)23-13-22-16/h3-10H,2,11-13H2,1H3 |
| InChIKey | XIMXDCTXUVFMAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |