benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate

C18H19NO4 — CID 70700680

IUPACbenzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate
SMILESCCN(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1
InChIInChI=1S/C18H19NO4/c1-2-19(18(20)21-12-14-6-4-3-5-7-14)11-15-8-9-16-17(10-15)23-13-22-16/h3-10H,2,11-13H2,1H3
InChIKeyXIMXDCTXUVFMAW-UHFFFAOYSA-N
MW313.35 g/mol
LogP3.57
Rot. Bonds5

About benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate

benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate (PubChem CID 70700680) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate.

Molecular Properties

Compound Namebenzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate
PubChem CID70700680
Molecular FormulaC18H19NO4
Molecular Weight313.35 g/mol
Exact Mass313.13
IUPAC Namebenzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate
SMILESCCN(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1
InChIInChI=1S/C18H19NO4/c1-2-19(18(20)21-12-14-6-4-3-5-7-14)11-15-8-9-16-17(10-15)23-13-22-16/h3-10H,2,11-13H2,1H3
InChIKeyXIMXDCTXUVFMAW-UHFFFAOYSA-N
XLogP3.57
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.35
LogP ≤ 53.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate?
The IUPAC name of benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate (CID 70700680) is benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate.
What is the SMILES notation for benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate?
The canonical SMILES for benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate is CCN(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate?
The InChIKey is XIMXDCTXUVFMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-2-19(18(20)21-12-14-6-4-3-5-7-14)11-15-8-9-16-17(10-15)23-13-22-16/h3-10H,2,11-13H2,1H3.
What are the key properties of benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate?
benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate has a molecular weight of 313.35 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamate is sourced from PubChem (CID 70700680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).