C17H17FN2O3 — CID 24612399
1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-fluorophenyl)urea (PubChem CID 24612399) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-fluorophenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 24612399 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-fluorophenyl)urea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O3/c1-2-20(17(21)19-14-6-4-3-5-13(14)18)10-12-7-8-15-16(9-12)23-11-22-15/h3-9H,2,10-11H2,1H3,(H,19,21) |
| InChIKey | KXYYFGISLWOORD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |