C17H25N3O4 — CID 113163211
2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 113163211) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 113163211 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | CC(=O)N(CC(=O)NCCCN(C)C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H25N3O4/c1-13(21)20(11-17(22)18-7-4-8-19(2)3)10-14-5-6-15-16(9-14)24-12-23-15/h5-6,9H,4,7-8,10-12H2,1-3H3,(H,18,22) |
| InChIKey | STKJNRDATLUYHK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|