C16H25N3O5S — CID 113151358
2-[1,3-benzodioxol-5-ylmethyl(methylsulfonyl)amino]-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 113151358) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl(methylsulfonyl)amino]-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl(methylsulfonyl)amino]-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 113151358 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl(methylsulfonyl)amino]-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | CN(C)CCCNC(=O)CN(Cc1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C16H25N3O5S/c1-18(2)8-4-7-17-16(20)11-19(25(3,21)22)10-13-5-6-14-15(9-13)24-12-23-14/h5-6,9H,4,7-8,10-12H2,1-3H3,(H,17,20) |
| InChIKey | XLGWDPPOIJCUFD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|