C14H18N2O5S — CID 113148075
N-(1,3-benzodioxol-5-ylmethyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide (PubChem CID 113148075) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 113148075 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[methylsulfonyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)NCc1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C14H18N2O5S/c1-3-6-16(22(2,18)19)9-14(17)15-8-11-4-5-12-13(7-11)21-10-20-12/h3-5,7H,1,6,8-10H2,2H3,(H,15,17) |
| InChIKey | BUIJJKOCEFAZDB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|