C15H24ClN3O3 — CID 120623191
5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride (PubChem CID 120623191) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120623191 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-(2-methoxyethyl)-2-methylbenzamide;hydrochloride |
| SMILES | COCCN(CC(=O)N(C)C)C(=O)c1cc(N)ccc1C.Cl |
| InChI | InChI=1S/C15H23N3O3.ClH/c1-11-5-6-12(16)9-13(11)15(20)18(7-8-21-4)10-14(19)17(2)3;/h5-6,9H,7-8,10,16H2,1-4H3;1H |
| InChIKey | NMYDZADKCORQOI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|