C17H18FmNO4- — CID 168915522
3-[4-(cyclohexa-1,3-dien-1-ylmethoxy)phenyl]-2-(oxomethylamino)propanoic acid;fermium (PubChem CID 168915522) has the molecular formula C17H18FmNO4- and a molecular weight of 557.33 g/mol. Its IUPAC name is 3-[4-(cyclohexa-1,3-dien-1-ylmethoxy)phenyl]-2-(oxomethylamino)propanoic acid;fermium.
| Compound Name | 3-[4-(cyclohexa-1,3-dien-1-ylmethoxy)phenyl]-2-(oxomethylamino)propanoic acid;fermium |
|---|---|
| PubChem CID | 168915522 |
| Molecular Formula | C17H18FmNO4- |
| Molecular Weight | 557.33 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 3-[4-(cyclohexa-1,3-dien-1-ylmethoxy)phenyl]-2-(oxomethylamino)propanoic acid;fermium |
| SMILES | O=[C-]NC(Cc1ccc(OCC2=CC=CCC2)cc1)C(=O)O.[Fm] |
| InChI | InChI=1S/C17H18NO4.Fm/c19-12-18-16(17(20)21)10-13-6-8-15(9-7-13)22-11-14-4-2-1-3-5-14;/h1-2,4,6-9,16H,3,5,10-11H2,(H,18,19)(H,20,21);/q-1; |
| InChIKey | XIDHSDOGHNBNJX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|