C12H15FmN2O4- — CID 178135006
2-amino-3-[4-[2-(oxomethylamino)ethoxy]phenyl]propanoic acid;fermium (PubChem CID 178135006) has the molecular formula C12H15FmN2O4- and a molecular weight of 508.26 g/mol. Its IUPAC name is 2-amino-3-[4-[2-(oxomethylamino)ethoxy]phenyl]propanoic acid;fermium.
| Compound Name | 2-amino-3-[4-[2-(oxomethylamino)ethoxy]phenyl]propanoic acid;fermium |
|---|---|
| PubChem CID | 178135006 |
| Molecular Formula | C12H15FmN2O4- |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-amino-3-[4-[2-(oxomethylamino)ethoxy]phenyl]propanoic acid;fermium |
| SMILES | NC(Cc1ccc(OCCN[C-]=O)cc1)C(=O)O.[Fm] |
| InChI | InChI=1S/C12H15N2O4.Fm/c13-11(12(16)17)7-9-1-3-10(4-2-9)18-6-5-14-8-15;/h1-4,11H,5-7,13H2,(H,14,15)(H,16,17);/q-1; |
| InChIKey | QKKOPYBORNXYHQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|