C14H22ClNO3 — CID 118157824
2-amino-3-[4-(3-methylbutoxy)phenyl]propanoic acid;hydrochloride (PubChem CID 118157824) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-amino-3-[4-(3-methylbutoxy)phenyl]propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[4-(3-methylbutoxy)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 118157824 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-amino-3-[4-(3-methylbutoxy)phenyl]propanoic acid;hydrochloride |
| SMILES | CC(C)CCOc1ccc(CC(N)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-10(2)7-8-18-12-5-3-11(4-6-12)9-13(15)14(16)17;/h3-6,10,13H,7-9,15H2,1-2H3,(H,16,17);1H |
| InChIKey | QIZMKLJUJYEOEJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |