C12H17ClFNO3 — CID 118157791
(2S)-2-amino-3-[4-(3-fluoropropoxy)phenyl]propanoic acid;hydrochloride (PubChem CID 118157791) has the molecular formula C12H17ClFNO3 and a molecular weight of 277.72 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(3-fluoropropoxy)phenyl]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-[4-(3-fluoropropoxy)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 118157791 |
| Molecular Formula | C12H17ClFNO3 |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (2S)-2-amino-3-[4-(3-fluoropropoxy)phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccc(OCCCF)cc1)C(=O)O |
| InChI | InChI=1S/C12H16FNO3.ClH/c13-6-1-7-17-10-4-2-9(3-5-10)8-11(14)12(15)16;/h2-5,11H,1,6-8,14H2,(H,15,16);1H/t11-;/m0./s1 |
| InChIKey | NGVNZYOXTQGIDK-MERQFXBCSA-N |
| XLogP | 1.80 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|