C15H20FNO5 — CID 70675127
2-amino-4-[[4-(3-(18F)fluoropropoxy)phenyl]methyl]pentanedioic acid (PubChem CID 70675127) has the molecular formula C15H20FNO5 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-amino-4-[[4-(3-(18F)fluoropropoxy)phenyl]methyl]pentanedioic acid.
| Compound Name | 2-amino-4-[[4-(3-(18F)fluoropropoxy)phenyl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 70675127 |
| Molecular Formula | C15H20FNO5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-amino-4-[[4-(3-(18F)fluoropropoxy)phenyl]methyl]pentanedioic acid |
| SMILES | NC(CC(Cc1ccc(OCCC[18F])cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20FNO5/c16-6-1-7-22-12-4-2-10(3-5-12)8-11(14(18)19)9-13(17)15(20)21/h2-5,11,13H,1,6-9,17H2,(H,18,19)(H,20,21)/i16-1 |
| InChIKey | VEPCBBRJGDIEOH-GKTGUEEDSA-N |
| XLogP | 1.47 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|